C8H12N2O — CID 67281777
2,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazin-1-one (PubChem CID 67281777) has the molecular formula C8H12N2O and a molecular weight of 152.20 g/mol. Its IUPAC name is 2,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazin-1-one.
| Compound Name | 2,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazin-1-one |
|---|---|
| PubChem CID | 67281777 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 2,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazin-1-one |
| SMILES | O=C1NC=CN2CCCCC12 |
| InChI | InChI=1S/C8H12N2O/c11-8-7-3-1-2-5-10(7)6-4-9-8/h4,6-7H,1-3,5H2,(H,9,11) |
| InChIKey | XLHCFSQKBVRCJA-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |