About [2-[(2,4-dimethylpyrimidin-5-yl)oxymethyl]cyclopropyl]methanol
[2-[(2,4-dimethylpyrimidin-5-yl)oxymethyl]cyclopropyl]methanol (PubChem CID 67281799) has the molecular formula C11H16N2O2
and a molecular weight of 208.26 g/mol. Its IUPAC name is [2-[(2,4-dimethylpyrimidin-5-yl)oxymethyl]cyclopropyl]methanol.
Molecular Properties
| Compound Name | [2-[(2,4-dimethylpyrimidin-5-yl)oxymethyl]cyclopropyl]methanol |
| PubChem CID | 67281799 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | [2-[(2,4-dimethylpyrimidin-5-yl)oxymethyl]cyclopropyl]methanol |
| SMILES | Cc1ncc(OCC2CC2CO)c(C)n1 |
| InChI | InChI=1S/C11H16N2O2/c1-7-11(4-12-8(2)13-7)15-6-10-3-9(10)5-14/h4,9-10,14H,3,5-6H2,1-2H3 |
| InChIKey | QETKAYHEWQPZJF-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-[(2,4-dimethylpyrimidin-5-yl)oxymethyl]cyclopropyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(2,4-dimethylpyrimidin-5-yl)oxymethyl]cyclopropyl]methanol?
The IUPAC name of [2-[(2,4-dimethylpyrimidin-5-yl)oxymethyl]cyclopropyl]methanol (CID 67281799) is [2-[(2,4-dimethylpyrimidin-5-yl)oxymethyl]cyclopropyl]methanol.
What is the SMILES notation for [2-[(2,4-dimethylpyrimidin-5-yl)oxymethyl]cyclopropyl]methanol?
The canonical SMILES for [2-[(2,4-dimethylpyrimidin-5-yl)oxymethyl]cyclopropyl]methanol is Cc1ncc(OCC2CC2CO)c(C)n1.
What is the InChIKey of [2-[(2,4-dimethylpyrimidin-5-yl)oxymethyl]cyclopropyl]methanol?
The InChIKey is QETKAYHEWQPZJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O2/c1-7-11(4-12-8(2)13-7)15-6-10-3-9(10)5-14/h4,9-10,14H,3,5-6H2,1-2H3.
What are the key properties of [2-[(2,4-dimethylpyrimidin-5-yl)oxymethyl]cyclopropyl]methanol?
[2-[(2,4-dimethylpyrimidin-5-yl)oxymethyl]cyclopropyl]methanol has a molecular weight of 208.26 g/mol, XLogP of 1.10, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2,4-dimethylpyrimidin-5-yl)oxymethyl]cyclopropyl]methanol is sourced from PubChem (CID 67281799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).