About 6,6a-dihydro-3aH-furo[3,2-b]furan-5-one
6,6a-dihydro-3aH-furo[3,2-b]furan-5-one (PubChem CID 67281853) has the molecular formula C6H6O3
and a molecular weight of 126.11 g/mol. Its IUPAC name is 6,6a-dihydro-3aH-furo[3,2-b]furan-5-one.
Molecular Properties
| Compound Name | 6,6a-dihydro-3aH-furo[3,2-b]furan-5-one |
| PubChem CID | 67281853 |
| Molecular Formula | C6H6O3 |
| Molecular Weight | 126.11 g/mol |
| Exact Mass | 126.03 |
| IUPAC Name | 6,6a-dihydro-3aH-furo[3,2-b]furan-5-one |
| SMILES | O=C1CC2OC=CC2O1 |
| InChI | InChI=1S/C6H6O3/c7-6-3-5-4(9-6)1-2-8-5/h1-2,4-5H,3H2 |
| InChIKey | GUDYUBNNQIAJTL-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.11 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,6a-dihydro-3aH-furo[3,2-b]furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6a-dihydro-3aH-furo[3,2-b]furan-5-one?
The IUPAC name of 6,6a-dihydro-3aH-furo[3,2-b]furan-5-one (CID 67281853) is 6,6a-dihydro-3aH-furo[3,2-b]furan-5-one.
What is the SMILES notation for 6,6a-dihydro-3aH-furo[3,2-b]furan-5-one?
The canonical SMILES for 6,6a-dihydro-3aH-furo[3,2-b]furan-5-one is O=C1CC2OC=CC2O1.
What is the InChIKey of 6,6a-dihydro-3aH-furo[3,2-b]furan-5-one?
The InChIKey is GUDYUBNNQIAJTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O3/c7-6-3-5-4(9-6)1-2-8-5/h1-2,4-5H,3H2.
What are the key properties of 6,6a-dihydro-3aH-furo[3,2-b]furan-5-one?
6,6a-dihydro-3aH-furo[3,2-b]furan-5-one has a molecular weight of 126.11 g/mol, XLogP of 0.21, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6a-dihydro-3aH-furo[3,2-b]furan-5-one is sourced from PubChem (CID 67281853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).