About 2-(4-hydroxy-6-oxo-1H-pyrimidin-2-yl)-N,N-dimethylacetamide
2-(4-hydroxy-6-oxo-1H-pyrimidin-2-yl)-N,N-dimethylacetamide (PubChem CID 67282633) has the molecular formula C8H11N3O3
and a molecular weight of 197.19 g/mol. Its IUPAC name is 2-(4-hydroxy-6-oxo-1H-pyrimidin-2-yl)-N,N-dimethylacetamide.
Molecular Properties
| Compound Name | 2-(4-hydroxy-6-oxo-1H-pyrimidin-2-yl)-N,N-dimethylacetamide |
| PubChem CID | 67282633 |
| Molecular Formula | C8H11N3O3 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 2-(4-hydroxy-6-oxo-1H-pyrimidin-2-yl)-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)Cc1nc(O)cc(=O)[nH]1 |
| InChI | InChI=1S/C8H11N3O3/c1-11(2)8(14)3-5-9-6(12)4-7(13)10-5/h4H,3H2,1-2H3,(H2,9,10,12,13) |
| InChIKey | XLDNWGPOWHTTOS-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-hydroxy-6-oxo-1H-pyrimidin-2-yl)-N,N-dimethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-hydroxy-6-oxo-1H-pyrimidin-2-yl)-N,N-dimethylacetamide?
The IUPAC name of 2-(4-hydroxy-6-oxo-1H-pyrimidin-2-yl)-N,N-dimethylacetamide (CID 67282633) is 2-(4-hydroxy-6-oxo-1H-pyrimidin-2-yl)-N,N-dimethylacetamide.
What is the SMILES notation for 2-(4-hydroxy-6-oxo-1H-pyrimidin-2-yl)-N,N-dimethylacetamide?
The canonical SMILES for 2-(4-hydroxy-6-oxo-1H-pyrimidin-2-yl)-N,N-dimethylacetamide is CN(C)C(=O)Cc1nc(O)cc(=O)[nH]1.
What is the InChIKey of 2-(4-hydroxy-6-oxo-1H-pyrimidin-2-yl)-N,N-dimethylacetamide?
The InChIKey is XLDNWGPOWHTTOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O3/c1-11(2)8(14)3-5-9-6(12)4-7(13)10-5/h4H,3H2,1-2H3,(H2,9,10,12,13).
What are the key properties of 2-(4-hydroxy-6-oxo-1H-pyrimidin-2-yl)-N,N-dimethylacetamide?
2-(4-hydroxy-6-oxo-1H-pyrimidin-2-yl)-N,N-dimethylacetamide has a molecular weight of 197.19 g/mol, XLogP of -0.89, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-hydroxy-6-oxo-1H-pyrimidin-2-yl)-N,N-dimethylacetamide is sourced from PubChem (CID 67282633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).