About [3-[4-(2,4-dimethoxyphenyl)piperazin-1-yl]-1-phenylpropyl] carbamate
[3-[4-(2,4-dimethoxyphenyl)piperazin-1-yl]-1-phenylpropyl] carbamate (PubChem CID 67282851) has the molecular formula C22H29N3O4
and a molecular weight of 399.49 g/mol. Its IUPAC name is [3-[4-(2,4-dimethoxyphenyl)piperazin-1-yl]-1-phenylpropyl] carbamate.
Molecular Properties
| Compound Name | [3-[4-(2,4-dimethoxyphenyl)piperazin-1-yl]-1-phenylpropyl] carbamate |
| PubChem CID | 67282851 |
| Molecular Formula | C22H29N3O4 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | [3-[4-(2,4-dimethoxyphenyl)piperazin-1-yl]-1-phenylpropyl] carbamate |
| SMILES | COc1ccc(N2CCN(CCC(OC(N)=O)c3ccccc3)CC2)c(OC)c1 |
| InChI | InChI=1S/C22H29N3O4/c1-27-18-8-9-19(21(16-18)28-2)25-14-12-24(13-15-25)11-10-20(29-22(23)26)17-6-4-3-5-7-17/h3-9,16,20H,10-15H2,1-2H3,(H2,23,26) |
| InChIKey | JXFLFQAXIHSTKK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 77.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze [3-[4-(2,4-dimethoxyphenyl)piperazin-1-yl]-1-phenylpropyl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[4-(2,4-dimethoxyphenyl)piperazin-1-yl]-1-phenylpropyl] carbamate?
The IUPAC name of [3-[4-(2,4-dimethoxyphenyl)piperazin-1-yl]-1-phenylpropyl] carbamate (CID 67282851) is [3-[4-(2,4-dimethoxyphenyl)piperazin-1-yl]-1-phenylpropyl] carbamate.
What is the SMILES notation for [3-[4-(2,4-dimethoxyphenyl)piperazin-1-yl]-1-phenylpropyl] carbamate?
The canonical SMILES for [3-[4-(2,4-dimethoxyphenyl)piperazin-1-yl]-1-phenylpropyl] carbamate is COc1ccc(N2CCN(CCC(OC(N)=O)c3ccccc3)CC2)c(OC)c1.
What is the InChIKey of [3-[4-(2,4-dimethoxyphenyl)piperazin-1-yl]-1-phenylpropyl] carbamate?
The InChIKey is JXFLFQAXIHSTKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29N3O4/c1-27-18-8-9-19(21(16-18)28-2)25-14-12-24(13-15-25)11-10-20(29-22(23)26)17-6-4-3-5-7-17/h3-9,16,20H,10-15H2,1-2H3,(H2,23,26).
What are the key properties of [3-[4-(2,4-dimethoxyphenyl)piperazin-1-yl]-1-phenylpropyl] carbamate?
[3-[4-(2,4-dimethoxyphenyl)piperazin-1-yl]-1-phenylpropyl] carbamate has a molecular weight of 399.49 g/mol, XLogP of 3.05, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[4-(2,4-dimethoxyphenyl)piperazin-1-yl]-1-phenylpropyl] carbamate is sourced from PubChem (CID 67282851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).