About 3-(1,4-oxazepan-2-yl)pyrimidin-4-one
3-(1,4-oxazepan-2-yl)pyrimidin-4-one (PubChem CID 67283089) has the molecular formula C9H13N3O2
and a molecular weight of 195.22 g/mol. Its IUPAC name is 3-(1,4-oxazepan-2-yl)pyrimidin-4-one.
Molecular Properties
| Compound Name | 3-(1,4-oxazepan-2-yl)pyrimidin-4-one |
| PubChem CID | 67283089 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 3-(1,4-oxazepan-2-yl)pyrimidin-4-one |
| SMILES | O=c1ccncn1C1CNCCCO1 |
| InChI | InChI=1S/C9H13N3O2/c13-8-2-4-11-7-12(8)9-6-10-3-1-5-14-9/h2,4,7,9-10H,1,3,5-6H2 |
| InChIKey | RQODWJKYULVUJL-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(1,4-oxazepan-2-yl)pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,4-oxazepan-2-yl)pyrimidin-4-one?
The IUPAC name of 3-(1,4-oxazepan-2-yl)pyrimidin-4-one (CID 67283089) is 3-(1,4-oxazepan-2-yl)pyrimidin-4-one.
What is the SMILES notation for 3-(1,4-oxazepan-2-yl)pyrimidin-4-one?
The canonical SMILES for 3-(1,4-oxazepan-2-yl)pyrimidin-4-one is O=c1ccncn1C1CNCCCO1.
What is the InChIKey of 3-(1,4-oxazepan-2-yl)pyrimidin-4-one?
The InChIKey is RQODWJKYULVUJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O2/c13-8-2-4-11-7-12(8)9-6-10-3-1-5-14-9/h2,4,7,9-10H,1,3,5-6H2.
What are the key properties of 3-(1,4-oxazepan-2-yl)pyrimidin-4-one?
3-(1,4-oxazepan-2-yl)pyrimidin-4-one has a molecular weight of 195.22 g/mol, XLogP of -0.25, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,4-oxazepan-2-yl)pyrimidin-4-one is sourced from PubChem (CID 67283089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).