About 2-(1,4-oxazepan-3-yl)-1H-pyrimidin-6-one
2-(1,4-oxazepan-3-yl)-1H-pyrimidin-6-one (PubChem CID 67283090) has the molecular formula C9H13N3O2
and a molecular weight of 195.22 g/mol. Its IUPAC name is 2-(1,4-oxazepan-3-yl)-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 2-(1,4-oxazepan-3-yl)-1H-pyrimidin-6-one |
| PubChem CID | 67283090 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 2-(1,4-oxazepan-3-yl)-1H-pyrimidin-6-one |
| SMILES | O=c1ccnc(C2COCCCN2)[nH]1 |
| InChI | InChI=1S/C9H13N3O2/c13-8-2-4-11-9(12-8)7-6-14-5-1-3-10-7/h2,4,7,10H,1,3,5-6H2,(H,11,12,13) |
| InChIKey | ZJCZMGONEZADFU-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1,4-oxazepan-3-yl)-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,4-oxazepan-3-yl)-1H-pyrimidin-6-one?
The IUPAC name of 2-(1,4-oxazepan-3-yl)-1H-pyrimidin-6-one (CID 67283090) is 2-(1,4-oxazepan-3-yl)-1H-pyrimidin-6-one.
What is the SMILES notation for 2-(1,4-oxazepan-3-yl)-1H-pyrimidin-6-one?
The canonical SMILES for 2-(1,4-oxazepan-3-yl)-1H-pyrimidin-6-one is O=c1ccnc(C2COCCCN2)[nH]1.
What is the InChIKey of 2-(1,4-oxazepan-3-yl)-1H-pyrimidin-6-one?
The InChIKey is ZJCZMGONEZADFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O2/c13-8-2-4-11-9(12-8)7-6-14-5-1-3-10-7/h2,4,7,10H,1,3,5-6H2,(H,11,12,13).
What are the key properties of 2-(1,4-oxazepan-3-yl)-1H-pyrimidin-6-one?
2-(1,4-oxazepan-3-yl)-1H-pyrimidin-6-one has a molecular weight of 195.22 g/mol, XLogP of -0.18, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,4-oxazepan-3-yl)-1H-pyrimidin-6-one is sourced from PubChem (CID 67283090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).