C21H24O3 — CID 67283452
4-(2,6-diethyl-4-methylphenyl)-5-methoxy-10-oxatricyclo[5.2.1.02,6]deca-4,8-dien-3-one (PubChem CID 67283452) has the molecular formula C21H24O3 and a molecular weight of 324.42 g/mol. Its IUPAC name is 4-(2,6-diethyl-4-methylphenyl)-5-methoxy-10-oxatricyclo[5.2.1.02,6]deca-4,8-dien-3-one.
| Compound Name | 4-(2,6-diethyl-4-methylphenyl)-5-methoxy-10-oxatricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
|---|---|
| PubChem CID | 67283452 |
| Molecular Formula | C21H24O3 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 4-(2,6-diethyl-4-methylphenyl)-5-methoxy-10-oxatricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
| SMILES | CCc1cc(C)cc(CC)c1C1=C(OC)C2C3C=CC(O3)C2C1=O |
| InChI | InChI=1S/C21H24O3/c1-5-12-9-11(3)10-13(6-2)16(12)19-20(22)17-14-7-8-15(24-14)18(17)21(19)23-4/h7-10,14-15,17-18H,5-6H2,1-4H3 |
| InChIKey | IXKWJQMJAMDIRA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|