C21H20F3N5O3 — CID 67283526
4-[[[4-(3-prop-2-enoxyanilino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]methyl]phenol (PubChem CID 67283526) has the molecular formula C21H20F3N5O3 and a molecular weight of 447.42 g/mol. Its IUPAC name is 4-[[[4-(3-prop-2-enoxyanilino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]methyl]phenol.
| Compound Name | 4-[[[4-(3-prop-2-enoxyanilino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]methyl]phenol |
|---|---|
| PubChem CID | 67283526 |
| Molecular Formula | C21H20F3N5O3 |
| Molecular Weight | 447.42 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | 4-[[[4-(3-prop-2-enoxyanilino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]methyl]phenol |
| SMILES | C=CCOc1cccc(Nc2nc(NCc3ccc(O)cc3)nc(OCC(F)(F)F)n2)c1 |
| InChI | InChI=1S/C21H20F3N5O3/c1-2-10-31-17-5-3-4-15(11-17)26-19-27-18(25-12-14-6-8-16(30)9-7-14)28-20(29-19)32-13-21(22,23)24/h2-9,11,30H,1,10,12-13H2,(H2,25,26,27,28,29) |
| InChIKey | QJEYQAFXXIOXCI-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 101.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.42 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|