C23H22F3N5O3 — CID 67283589
4-[1-[[4-(3-prop-2-enoxyanilino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]cyclopropyl]phenol (PubChem CID 67283589) has the molecular formula C23H22F3N5O3 and a molecular weight of 473.46 g/mol. Its IUPAC name is 4-[1-[[4-(3-prop-2-enoxyanilino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]cyclopropyl]phenol.
| Compound Name | 4-[1-[[4-(3-prop-2-enoxyanilino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]cyclopropyl]phenol |
|---|---|
| PubChem CID | 67283589 |
| Molecular Formula | C23H22F3N5O3 |
| Molecular Weight | 473.46 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | 4-[1-[[4-(3-prop-2-enoxyanilino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]cyclopropyl]phenol |
| SMILES | C=CCOc1cccc(Nc2nc(NC3(c4ccc(O)cc4)CC3)nc(OCC(F)(F)F)n2)c1 |
| InChI | InChI=1S/C23H22F3N5O3/c1-2-12-33-18-5-3-4-16(13-18)27-19-28-20(30-21(29-19)34-14-23(24,25)26)31-22(10-11-22)15-6-8-17(32)9-7-15/h2-9,13,32H,1,10-12,14H2,(H2,27,28,29,30,31) |
| InChIKey | RXMUKUYCCNSFQR-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 101.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.46 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|