C26H26F3N5O3 — CID 67283672
4-N-(3-prop-2-enoxyphenyl)-2-N-[1-(4-prop-2-enoxyphenyl)cyclopropyl]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine (PubChem CID 67283672) has the molecular formula C26H26F3N5O3 and a molecular weight of 513.52 g/mol. Its IUPAC name is 4-N-(3-prop-2-enoxyphenyl)-2-N-[1-(4-prop-2-enoxyphenyl)cyclopropyl]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-(3-prop-2-enoxyphenyl)-2-N-[1-(4-prop-2-enoxyphenyl)cyclopropyl]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 67283672 |
| Molecular Formula | C26H26F3N5O3 |
| Molecular Weight | 513.52 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | 4-N-(3-prop-2-enoxyphenyl)-2-N-[1-(4-prop-2-enoxyphenyl)cyclopropyl]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine |
| SMILES | C=CCOc1ccc(C2(Nc3nc(Nc4cccc(OCC=C)c4)nc(OCC(F)(F)F)n3)CC2)cc1 |
| InChI | InChI=1S/C26H26F3N5O3/c1-3-14-35-20-10-8-18(9-11-20)25(12-13-25)34-23-31-22(32-24(33-23)37-17-26(27,28)29)30-19-6-5-7-21(16-19)36-15-4-2/h3-11,16H,1-2,12-15,17H2,(H2,30,31,32,33,34) |
| InChIKey | KQAXKHLCGFRSRS-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.52 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|