C18H23F3N6O3 — CID 67284209
3-[[4-(6-aminohexylamino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoic acid (PubChem CID 67284209) has the molecular formula C18H23F3N6O3 and a molecular weight of 428.42 g/mol. Its IUPAC name is 3-[[4-(6-aminohexylamino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoic acid.
| Compound Name | 3-[[4-(6-aminohexylamino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 67284209 |
| Molecular Formula | C18H23F3N6O3 |
| Molecular Weight | 428.42 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 3-[[4-(6-aminohexylamino)-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoic acid |
| SMILES | NCCCCCCNc1nc(Nc2cccc(C(=O)O)c2)nc(OCC(F)(F)F)n1 |
| InChI | InChI=1S/C18H23F3N6O3/c19-18(20,21)11-30-17-26-15(23-9-4-2-1-3-8-22)25-16(27-17)24-13-7-5-6-12(10-13)14(28)29/h5-7,10H,1-4,8-9,11,22H2,(H,28,29)(H2,23,24,25,26,27) |
| InChIKey | RKEYLAJRFYHSIZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 135.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|