C32H36N4O7S — CID 67284447
but-2-enedioic acid;5-(3-ethylsulfonylphenyl)-3,8-dimethyl-N-(1-methylpiperidin-4-yl)-9H-pyrido[2,3-b]indole-7-carboxamide (PubChem CID 67284447) has the molecular formula C32H36N4O7S and a molecular weight of 620.73 g/mol. Its IUPAC name is but-2-enedioic acid;5-(3-ethylsulfonylphenyl)-3,8-dimethyl-N-(1-methylpiperidin-4-yl)-9H-pyrido[2,3-b]indole-7-carboxamide.
| Compound Name | but-2-enedioic acid;5-(3-ethylsulfonylphenyl)-3,8-dimethyl-N-(1-methylpiperidin-4-yl)-9H-pyrido[2,3-b]indole-7-carboxamide |
|---|---|
| PubChem CID | 67284447 |
| Molecular Formula | C32H36N4O7S |
| Molecular Weight | 620.73 g/mol |
| Exact Mass | 620.23 |
| IUPAC Name | but-2-enedioic acid;5-(3-ethylsulfonylphenyl)-3,8-dimethyl-N-(1-methylpiperidin-4-yl)-9H-pyrido[2,3-b]indole-7-carboxamide |
| SMILES | CCS(=O)(=O)c1cccc(-c2cc(C(=O)NC3CCN(C)CC3)c(C)c3[nH]c4ncc(C)cc4c23)c1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C28H32N4O3S.C4H4O4/c1-5-36(34,35)21-8-6-7-19(14-21)23-15-22(28(33)30-20-9-11-32(4)12-10-20)18(3)26-25(23)24-13-17(2)16-29-27(24)31-26;5-3(6)1-2-4(7)8/h6-8,13-16,20H,5,9-12H2,1-4H3,(H,29,31)(H,30,33);1-2H,(H,5,6)(H,7,8) |
| InChIKey | FMZRDHJNARAJJX-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 169.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.73 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|