C26H21ClFIN2 — CID 67284548
5-chloro-2-(2-fluorophenyl)-4-(6-iodo-3,3-dimethyl-2H-indol-1-yl)-3-methylquinoline (PubChem CID 67284548) has the molecular formula C26H21ClFIN2 and a molecular weight of 542.82 g/mol. Its IUPAC name is 5-chloro-2-(2-fluorophenyl)-4-(6-iodo-3,3-dimethyl-2H-indol-1-yl)-3-methylquinoline.
| Compound Name | 5-chloro-2-(2-fluorophenyl)-4-(6-iodo-3,3-dimethyl-2H-indol-1-yl)-3-methylquinoline |
|---|---|
| PubChem CID | 67284548 |
| Molecular Formula | C26H21ClFIN2 |
| Molecular Weight | 542.82 g/mol |
| Exact Mass | 542.04 |
| IUPAC Name | 5-chloro-2-(2-fluorophenyl)-4-(6-iodo-3,3-dimethyl-2H-indol-1-yl)-3-methylquinoline |
| SMILES | Cc1c(-c2ccccc2F)nc2cccc(Cl)c2c1N1CC(C)(C)c2ccc(I)cc21 |
| InChI | InChI=1S/C26H21ClFIN2/c1-15-24(17-7-4-5-9-20(17)28)30-21-10-6-8-19(27)23(21)25(15)31-14-26(2,3)18-12-11-16(29)13-22(18)31/h4-13H,14H2,1-3H3 |
| InChIKey | YRIQQAHQHCCJPE-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.82 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|