C28H31BrF3N5O4 — CID 67285134
tert-butyl 4-[[4-[[1-[4-(3-bromopropoxy)phenyl]cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoate (PubChem CID 67285134) has the molecular formula C28H31BrF3N5O4 and a molecular weight of 638.49 g/mol. Its IUPAC name is tert-butyl 4-[[4-[[1-[4-(3-bromopropoxy)phenyl]cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoate.
| Compound Name | tert-butyl 4-[[4-[[1-[4-(3-bromopropoxy)phenyl]cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 67285134 |
| Molecular Formula | C28H31BrF3N5O4 |
| Molecular Weight | 638.49 g/mol |
| Exact Mass | 637.15 |
| IUPAC Name | tert-butyl 4-[[4-[[1-[4-(3-bromopropoxy)phenyl]cyclopropyl]amino]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-yl]amino]benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(Nc2nc(NC3(c4ccc(OCCCBr)cc4)CC3)nc(OCC(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C28H31BrF3N5O4/c1-26(2,3)41-22(38)18-5-9-20(10-6-18)33-23-34-24(36-25(35-23)40-17-28(30,31)32)37-27(13-14-27)19-7-11-21(12-8-19)39-16-4-15-29/h5-12H,4,13-17H2,1-3H3,(H2,33,34,35,36,37) |
| InChIKey | NEJPGCFEKNQNNV-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.49 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|