C24H23F3N4O3S — CID 67285164
5-[5-(5-methyl-1,2,3,4-tetrahydroisoquinolin-6-yl)-1,3,4-thiadiazol-2-yl]-2-propan-2-yloxybenzonitrile;2,2,2-trifluoroacetic acid (PubChem CID 67285164) has the molecular formula C24H23F3N4O3S and a molecular weight of 504.53 g/mol. Its IUPAC name is 5-[5-(5-methyl-1,2,3,4-tetrahydroisoquinolin-6-yl)-1,3,4-thiadiazol-2-yl]-2-propan-2-yloxybenzonitrile;2,2,2-trifluoroacetic acid.
| Compound Name | 5-[5-(5-methyl-1,2,3,4-tetrahydroisoquinolin-6-yl)-1,3,4-thiadiazol-2-yl]-2-propan-2-yloxybenzonitrile;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67285164 |
| Molecular Formula | C24H23F3N4O3S |
| Molecular Weight | 504.53 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | 5-[5-(5-methyl-1,2,3,4-tetrahydroisoquinolin-6-yl)-1,3,4-thiadiazol-2-yl]-2-propan-2-yloxybenzonitrile;2,2,2-trifluoroacetic acid |
| SMILES | Cc1c(-c2nnc(-c3ccc(OC(C)C)c(C#N)c3)s2)ccc2c1CCNC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H22N4OS.C2HF3O2/c1-13(2)27-20-7-5-15(10-17(20)11-23)21-25-26-22(28-21)19-6-4-16-12-24-9-8-18(16)14(19)3;3-2(4,5)1(6)7/h4-7,10,13,24H,8-9,12H2,1-3H3;(H,6,7) |
| InChIKey | JBOOBCDQNUDGDJ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.53 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |