C24H26N6O5 — CID 67285760
tert-butyl 2-(2-aminopyrimidin-4-yl)-1-methyl-3-[(3-nitrophenyl)methyl]-4-oxo-6,7-dihydropyrrolo[3,2-c]pyridine-5-carboxylate (PubChem CID 67285760) has the molecular formula C24H26N6O5 and a molecular weight of 478.51 g/mol. Its IUPAC name is tert-butyl 2-(2-aminopyrimidin-4-yl)-1-methyl-3-[(3-nitrophenyl)methyl]-4-oxo-6,7-dihydropyrrolo[3,2-c]pyridine-5-carboxylate.
| Compound Name | tert-butyl 2-(2-aminopyrimidin-4-yl)-1-methyl-3-[(3-nitrophenyl)methyl]-4-oxo-6,7-dihydropyrrolo[3,2-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 67285760 |
| Molecular Formula | C24H26N6O5 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | tert-butyl 2-(2-aminopyrimidin-4-yl)-1-methyl-3-[(3-nitrophenyl)methyl]-4-oxo-6,7-dihydropyrrolo[3,2-c]pyridine-5-carboxylate |
| SMILES | Cn1c2c(c(Cc3cccc([N+](=O)[O-])c3)c1-c1ccnc(N)n1)C(=O)N(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C24H26N6O5/c1-24(2,3)35-23(32)29-11-9-18-19(21(29)31)16(13-14-6-5-7-15(12-14)30(33)34)20(28(18)4)17-8-10-26-22(25)27-17/h5-8,10,12H,9,11,13H2,1-4H3,(H2,25,26,27) |
| InChIKey | ORFXQWSGTPBBKM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 146.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|