About 1-ethyl-3-[2-(1-ethyl-2,5-dioxopyrrol-3-yl)oxyethoxy]pyrrole-2,5-dione
1-ethyl-3-[2-(1-ethyl-2,5-dioxopyrrol-3-yl)oxyethoxy]pyrrole-2,5-dione (PubChem CID 67285787) has the molecular formula C14H16N2O6
and a molecular weight of 308.29 g/mol. Its IUPAC name is 1-ethyl-3-[2-(1-ethyl-2,5-dioxopyrrol-3-yl)oxyethoxy]pyrrole-2,5-dione.
Molecular Properties
| Compound Name | 1-ethyl-3-[2-(1-ethyl-2,5-dioxopyrrol-3-yl)oxyethoxy]pyrrole-2,5-dione |
| PubChem CID | 67285787 |
| Molecular Formula | C14H16N2O6 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 1-ethyl-3-[2-(1-ethyl-2,5-dioxopyrrol-3-yl)oxyethoxy]pyrrole-2,5-dione |
| SMILES | CCN1C(=O)C=C(OCCOC2=CC(=O)N(CC)C2=O)C1=O |
| InChI | InChI=1S/C14H16N2O6/c1-3-15-11(17)7-9(13(15)19)21-5-6-22-10-8-12(18)16(4-2)14(10)20/h7-8H,3-6H2,1-2H3 |
| InChIKey | QQTMECFRFZZIES-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-3-[2-(1-ethyl-2,5-dioxopyrrol-3-yl)oxyethoxy]pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-[2-(1-ethyl-2,5-dioxopyrrol-3-yl)oxyethoxy]pyrrole-2,5-dione?
The IUPAC name of 1-ethyl-3-[2-(1-ethyl-2,5-dioxopyrrol-3-yl)oxyethoxy]pyrrole-2,5-dione (CID 67285787) is 1-ethyl-3-[2-(1-ethyl-2,5-dioxopyrrol-3-yl)oxyethoxy]pyrrole-2,5-dione.
What is the SMILES notation for 1-ethyl-3-[2-(1-ethyl-2,5-dioxopyrrol-3-yl)oxyethoxy]pyrrole-2,5-dione?
The canonical SMILES for 1-ethyl-3-[2-(1-ethyl-2,5-dioxopyrrol-3-yl)oxyethoxy]pyrrole-2,5-dione is CCN1C(=O)C=C(OCCOC2=CC(=O)N(CC)C2=O)C1=O.
What is the InChIKey of 1-ethyl-3-[2-(1-ethyl-2,5-dioxopyrrol-3-yl)oxyethoxy]pyrrole-2,5-dione?
The InChIKey is QQTMECFRFZZIES-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O6/c1-3-15-11(17)7-9(13(15)19)21-5-6-22-10-8-12(18)16(4-2)14(10)20/h7-8H,3-6H2,1-2H3.
What are the key properties of 1-ethyl-3-[2-(1-ethyl-2,5-dioxopyrrol-3-yl)oxyethoxy]pyrrole-2,5-dione?
1-ethyl-3-[2-(1-ethyl-2,5-dioxopyrrol-3-yl)oxyethoxy]pyrrole-2,5-dione has a molecular weight of 308.29 g/mol, XLogP of -0.44, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-[2-(1-ethyl-2,5-dioxopyrrol-3-yl)oxyethoxy]pyrrole-2,5-dione is sourced from PubChem (CID 67285787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).