About [2-(2,4-dimethylphenyl)imidazo[1,2-a]pyridin-6-yl] methyl carbonate
[2-(2,4-dimethylphenyl)imidazo[1,2-a]pyridin-6-yl] methyl carbonate (PubChem CID 67285844) has the molecular formula C17H16N2O3
and a molecular weight of 296.33 g/mol. Its IUPAC name is [2-(2,4-dimethylphenyl)imidazo[1,2-a]pyridin-6-yl] methyl carbonate.
Molecular Properties
| Compound Name | [2-(2,4-dimethylphenyl)imidazo[1,2-a]pyridin-6-yl] methyl carbonate |
| PubChem CID | 67285844 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | [2-(2,4-dimethylphenyl)imidazo[1,2-a]pyridin-6-yl] methyl carbonate |
| SMILES | COC(=O)Oc1ccc2nc(-c3ccc(C)cc3C)cn2c1 |
| InChI | InChI=1S/C17H16N2O3/c1-11-4-6-14(12(2)8-11)15-10-19-9-13(22-17(20)21-3)5-7-16(19)18-15/h4-10H,1-3H3 |
| InChIKey | IIUYHBLZCZPITI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(2,4-dimethylphenyl)imidazo[1,2-a]pyridin-6-yl] methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,4-dimethylphenyl)imidazo[1,2-a]pyridin-6-yl] methyl carbonate?
The IUPAC name of [2-(2,4-dimethylphenyl)imidazo[1,2-a]pyridin-6-yl] methyl carbonate (CID 67285844) is [2-(2,4-dimethylphenyl)imidazo[1,2-a]pyridin-6-yl] methyl carbonate.
What is the SMILES notation for [2-(2,4-dimethylphenyl)imidazo[1,2-a]pyridin-6-yl] methyl carbonate?
The canonical SMILES for [2-(2,4-dimethylphenyl)imidazo[1,2-a]pyridin-6-yl] methyl carbonate is COC(=O)Oc1ccc2nc(-c3ccc(C)cc3C)cn2c1.
What is the InChIKey of [2-(2,4-dimethylphenyl)imidazo[1,2-a]pyridin-6-yl] methyl carbonate?
The InChIKey is IIUYHBLZCZPITI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2O3/c1-11-4-6-14(12(2)8-11)15-10-19-9-13(22-17(20)21-3)5-7-16(19)18-15/h4-10H,1-3H3.
What are the key properties of [2-(2,4-dimethylphenyl)imidazo[1,2-a]pyridin-6-yl] methyl carbonate?
[2-(2,4-dimethylphenyl)imidazo[1,2-a]pyridin-6-yl] methyl carbonate has a molecular weight of 296.33 g/mol, XLogP of 3.76, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,4-dimethylphenyl)imidazo[1,2-a]pyridin-6-yl] methyl carbonate is sourced from PubChem (CID 67285844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).