C16H18N4O3 — CID 67286022
5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione;1-methylimidazole (PubChem CID 67286022) has the molecular formula C16H18N4O3 and a molecular weight of 314.35 g/mol. Its IUPAC name is 5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione;1-methylimidazole.
| Compound Name | 5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione;1-methylimidazole |
|---|---|
| PubChem CID | 67286022 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione;1-methylimidazole |
| SMILES | CCC1(c2ccccc2)C(=O)NC(=O)NC1=O.Cn1ccnc1 |
| InChI | InChI=1S/C12H12N2O3.C4H6N2/c1-2-12(8-6-4-3-5-7-8)9(15)13-11(17)14-10(12)16;1-6-3-2-5-4-6/h3-7H,2H2,1H3,(H2,13,14,15,16,17);2-4H,1H3 |
| InChIKey | RNEHGOLAOMVJCR-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|