About spiro[1,2-dihydroindole-3,4'-oxane]-6-carbonitrile
spiro[1,2-dihydroindole-3,4'-oxane]-6-carbonitrile (PubChem CID 67286131) has the molecular formula C13H14N2O
and a molecular weight of 214.27 g/mol. Its IUPAC name is spiro[1,2-dihydroindole-3,4'-oxane]-6-carbonitrile.
Molecular Properties
| Compound Name | spiro[1,2-dihydroindole-3,4'-oxane]-6-carbonitrile |
| PubChem CID | 67286131 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | spiro[1,2-dihydroindole-3,4'-oxane]-6-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)NCC21CCOCC1 |
| InChI | InChI=1S/C13H14N2O/c14-8-10-1-2-11-12(7-10)15-9-13(11)3-5-16-6-4-13/h1-2,7,15H,3-6,9H2 |
| InChIKey | GMYOZULPMKTXMA-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze spiro[1,2-dihydroindole-3,4'-oxane]-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1,2-dihydroindole-3,4'-oxane]-6-carbonitrile?
The IUPAC name of spiro[1,2-dihydroindole-3,4'-oxane]-6-carbonitrile (CID 67286131) is spiro[1,2-dihydroindole-3,4'-oxane]-6-carbonitrile.
What is the SMILES notation for spiro[1,2-dihydroindole-3,4'-oxane]-6-carbonitrile?
The canonical SMILES for spiro[1,2-dihydroindole-3,4'-oxane]-6-carbonitrile is N#Cc1ccc2c(c1)NCC21CCOCC1.
What is the InChIKey of spiro[1,2-dihydroindole-3,4'-oxane]-6-carbonitrile?
The InChIKey is GMYOZULPMKTXMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O/c14-8-10-1-2-11-12(7-10)15-9-13(11)3-5-16-6-4-13/h1-2,7,15H,3-6,9H2.
What are the key properties of spiro[1,2-dihydroindole-3,4'-oxane]-6-carbonitrile?
spiro[1,2-dihydroindole-3,4'-oxane]-6-carbonitrile has a molecular weight of 214.27 g/mol, XLogP of 2.03, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1,2-dihydroindole-3,4'-oxane]-6-carbonitrile is sourced from PubChem (CID 67286131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).