C16H12O4S3 — CID 67286373
2-[5-[5-[5-(carboxymethyl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]acetic acid (PubChem CID 67286373) has the molecular formula C16H12O4S3 and a molecular weight of 364.47 g/mol. Its IUPAC name is 2-[5-[5-[5-(carboxymethyl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]acetic acid.
| Compound Name | 2-[5-[5-[5-(carboxymethyl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]acetic acid |
|---|---|
| PubChem CID | 67286373 |
| Molecular Formula | C16H12O4S3 |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 363.99 |
| IUPAC Name | 2-[5-[5-[5-(carboxymethyl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]acetic acid |
| SMILES | O=C(O)Cc1ccc(-c2ccc(-c3ccc(CC(=O)O)s3)s2)s1 |
| InChI | InChI=1S/C16H12O4S3/c17-15(18)7-9-1-3-11(21-9)13-5-6-14(23-13)12-4-2-10(22-12)8-16(19)20/h1-6H,7-8H2,(H,17,18)(H,19,20) |
| InChIKey | LTSYZEUBNXOGRH-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |