C28H28FN5O3S2 — CID 67286434
1,3-benzothiazol-7-yl N-[[(1S,3R,4R)-2-[2-[ethyl(methyl)amino]-5-(4-fluorophenyl)-1,3-thiazole-4-carbonyl]-2-azabicyclo[2.2.1]heptan-3-yl]methyl]carbamate (PubChem CID 67286434) has the molecular formula C28H28FN5O3S2 and a molecular weight of 565.70 g/mol. Its IUPAC name is 1,3-benzothiazol-7-yl N-[[(1S,3R,4R)-2-[2-[ethyl(methyl)amino]-5-(4-fluorophenyl)-1,3-thiazole-4-carbonyl]-2-azabicyclo[2.2.1]heptan-3-yl]methyl]carbamate.
| Compound Name | 1,3-benzothiazol-7-yl N-[[(1S,3R,4R)-2-[2-[ethyl(methyl)amino]-5-(4-fluorophenyl)-1,3-thiazole-4-carbonyl]-2-azabicyclo[2.2.1]heptan-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 67286434 |
| Molecular Formula | C28H28FN5O3S2 |
| Molecular Weight | 565.70 g/mol |
| Exact Mass | 565.16 |
| IUPAC Name | 1,3-benzothiazol-7-yl N-[[(1S,3R,4R)-2-[2-[ethyl(methyl)amino]-5-(4-fluorophenyl)-1,3-thiazole-4-carbonyl]-2-azabicyclo[2.2.1]heptan-3-yl]methyl]carbamate |
| SMILES | CCN(C)c1nc(C(=O)N2[C@H]3CC[C@H](C3)[C@@H]2CNC(=O)Oc2cccc3ncsc23)c(-c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C28H28FN5O3S2/c1-3-33(2)27-32-23(24(39-27)16-7-10-18(29)11-8-16)26(35)34-19-12-9-17(13-19)21(34)14-30-28(36)37-22-6-4-5-20-25(22)38-15-31-20/h4-8,10-11,15,17,19,21H,3,9,12-14H2,1-2H3,(H,30,36)/t17-,19+,21+/m1/s1 |
| InChIKey | BMDXUWXSHWDBSE-LMNJBCLMSA-N |
| XLogP | 5.80 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.70 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |