C20H33N3O2S — CID 67286966
2-ethylsulfanyl-N-heptyl-4-methyl-6-morpholin-4-ylpyridine-3-carboxamide (PubChem CID 67286966) has the molecular formula C20H33N3O2S and a molecular weight of 379.57 g/mol. Its IUPAC name is 2-ethylsulfanyl-N-heptyl-4-methyl-6-morpholin-4-ylpyridine-3-carboxamide.
| Compound Name | 2-ethylsulfanyl-N-heptyl-4-methyl-6-morpholin-4-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 67286966 |
| Molecular Formula | C20H33N3O2S |
| Molecular Weight | 379.57 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | 2-ethylsulfanyl-N-heptyl-4-methyl-6-morpholin-4-ylpyridine-3-carboxamide |
| SMILES | CCCCCCCNC(=O)c1c(C)cc(N2CCOCC2)nc1SCC |
| InChI | InChI=1S/C20H33N3O2S/c1-4-6-7-8-9-10-21-19(24)18-16(3)15-17(22-20(18)26-5-2)23-11-13-25-14-12-23/h15H,4-14H2,1-3H3,(H,21,24) |
| InChIKey | GMARZIPXBAODBI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.57 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|