C19H24FN3O2S — CID 67287165
2-ethylsulfanyl-N-[(3-fluorophenyl)methyl]-6-(2-methoxyethylamino)-4-methylpyridine-3-carboxamide (PubChem CID 67287165) has the molecular formula C19H24FN3O2S and a molecular weight of 377.49 g/mol. Its IUPAC name is 2-ethylsulfanyl-N-[(3-fluorophenyl)methyl]-6-(2-methoxyethylamino)-4-methylpyridine-3-carboxamide.
| Compound Name | 2-ethylsulfanyl-N-[(3-fluorophenyl)methyl]-6-(2-methoxyethylamino)-4-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 67287165 |
| Molecular Formula | C19H24FN3O2S |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 2-ethylsulfanyl-N-[(3-fluorophenyl)methyl]-6-(2-methoxyethylamino)-4-methylpyridine-3-carboxamide |
| SMILES | CCSc1nc(NCCOC)cc(C)c1C(=O)NCc1cccc(F)c1 |
| InChI | InChI=1S/C19H24FN3O2S/c1-4-26-19-17(13(2)10-16(23-19)21-8-9-25-3)18(24)22-12-14-6-5-7-15(20)11-14/h5-7,10-11H,4,8-9,12H2,1-3H3,(H,21,23)(H,22,24) |
| InChIKey | MZSIGAGYEUNJDM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|