About 6-methoxy-1-nitrocyclohexa-2,4-dien-1-ol
6-methoxy-1-nitrocyclohexa-2,4-dien-1-ol (PubChem CID 67287285) has the molecular formula C7H9NO4
and a molecular weight of 171.15 g/mol. Its IUPAC name is 6-methoxy-1-nitrocyclohexa-2,4-dien-1-ol.
Molecular Properties
| Compound Name | 6-methoxy-1-nitrocyclohexa-2,4-dien-1-ol |
| PubChem CID | 67287285 |
| Molecular Formula | C7H9NO4 |
| Molecular Weight | 171.15 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | 6-methoxy-1-nitrocyclohexa-2,4-dien-1-ol |
| SMILES | COC1C=CC=CC1(O)[N+](=O)[O-] |
| InChI | InChI=1S/C7H9NO4/c1-12-6-4-2-3-5-7(6,9)8(10)11/h2-6,9H,1H3 |
| InChIKey | OLEWMZITTTUMKX-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.15 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-methoxy-1-nitrocyclohexa-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-1-nitrocyclohexa-2,4-dien-1-ol?
The IUPAC name of 6-methoxy-1-nitrocyclohexa-2,4-dien-1-ol (CID 67287285) is 6-methoxy-1-nitrocyclohexa-2,4-dien-1-ol.
What is the SMILES notation for 6-methoxy-1-nitrocyclohexa-2,4-dien-1-ol?
The canonical SMILES for 6-methoxy-1-nitrocyclohexa-2,4-dien-1-ol is COC1C=CC=CC1(O)[N+](=O)[O-].
What is the InChIKey of 6-methoxy-1-nitrocyclohexa-2,4-dien-1-ol?
The InChIKey is OLEWMZITTTUMKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO4/c1-12-6-4-2-3-5-7(6,9)8(10)11/h2-6,9H,1H3.
What are the key properties of 6-methoxy-1-nitrocyclohexa-2,4-dien-1-ol?
6-methoxy-1-nitrocyclohexa-2,4-dien-1-ol has a molecular weight of 171.15 g/mol, XLogP of 0.09, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-1-nitrocyclohexa-2,4-dien-1-ol is sourced from PubChem (CID 67287285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).