C28H24O3 — CID 67288051
[1-(9,9-dimethylfluoren-2-yl)naphthalen-2-yl] ethyl carbonate (PubChem CID 67288051) has the molecular formula C28H24O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is [1-(9,9-dimethylfluoren-2-yl)naphthalen-2-yl] ethyl carbonate.
| Compound Name | [1-(9,9-dimethylfluoren-2-yl)naphthalen-2-yl] ethyl carbonate |
|---|---|
| PubChem CID | 67288051 |
| Molecular Formula | C28H24O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | [1-(9,9-dimethylfluoren-2-yl)naphthalen-2-yl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccc2ccccc2c1-c1ccc2c(c1)C(C)(C)c1ccccc1-2 |
| InChI | InChI=1S/C28H24O3/c1-4-30-27(29)31-25-16-14-18-9-5-6-10-20(18)26(25)19-13-15-22-21-11-7-8-12-23(21)28(2,3)24(22)17-19/h5-17H,4H2,1-3H3 |
| InChIKey | HDVMJZHBGDJFJB-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|