C24H27F3N8O3S — CID 67289022
1-ethyl-3-[5-[5-(hydrazinecarbonyl)-2-(1-methylpiperidin-4-yl)oxy-3-pyridinyl]-4-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-2-pyridinyl]urea (PubChem CID 67289022) has the molecular formula C24H27F3N8O3S and a molecular weight of 564.59 g/mol. Its IUPAC name is 1-ethyl-3-[5-[5-(hydrazinecarbonyl)-2-(1-methylpiperidin-4-yl)oxy-3-pyridinyl]-4-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-2-pyridinyl]urea.
| Compound Name | 1-ethyl-3-[5-[5-(hydrazinecarbonyl)-2-(1-methylpiperidin-4-yl)oxy-3-pyridinyl]-4-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-2-pyridinyl]urea |
|---|---|
| PubChem CID | 67289022 |
| Molecular Formula | C24H27F3N8O3S |
| Molecular Weight | 564.59 g/mol |
| Exact Mass | 564.19 |
| IUPAC Name | 1-ethyl-3-[5-[5-(hydrazinecarbonyl)-2-(1-methylpiperidin-4-yl)oxy-3-pyridinyl]-4-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-2-pyridinyl]urea |
| SMILES | CCNC(=O)Nc1cc(-c2nc(C(F)(F)F)cs2)c(-c2cc(C(=O)NN)cnc2OC2CCN(C)CC2)cn1 |
| InChI | InChI=1S/C24H27F3N8O3S/c1-3-29-23(37)33-19-9-16(22-32-18(12-39-22)24(25,26)27)17(11-30-19)15-8-13(20(36)34-28)10-31-21(15)38-14-4-6-35(2)7-5-14/h8-12,14H,3-7,28H2,1-2H3,(H,34,36)(H2,29,30,33,37) |
| InChIKey | ABWIHNQRMKYFHC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 147.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.59 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|