C9H12F3N5O — CID 67289694
2-[3-(2,2,2-trifluoroethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]acetamide (PubChem CID 67289694) has the molecular formula C9H12F3N5O and a molecular weight of 263.22 g/mol. Its IUPAC name is 2-[3-(2,2,2-trifluoroethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]acetamide.
| Compound Name | 2-[3-(2,2,2-trifluoroethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]acetamide |
|---|---|
| PubChem CID | 67289694 |
| Molecular Formula | C9H12F3N5O |
| Molecular Weight | 263.22 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 2-[3-(2,2,2-trifluoroethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]acetamide |
| SMILES | NC(=O)CN1CCn2c(nnc2CC(F)(F)F)C1 |
| InChI | InChI=1S/C9H12F3N5O/c10-9(11,12)3-7-14-15-8-5-16(4-6(13)18)1-2-17(7)8/h1-5H2,(H2,13,18) |
| InChIKey | MGYKPRWMSZNWKD-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.22 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |