C9H14F3N5 — CID 67289695
2-[3-(2,2,2-trifluoroethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]ethanamine (PubChem CID 67289695) has the molecular formula C9H14F3N5 and a molecular weight of 249.24 g/mol. Its IUPAC name is 2-[3-(2,2,2-trifluoroethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]ethanamine.
| Compound Name | 2-[3-(2,2,2-trifluoroethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]ethanamine |
|---|---|
| PubChem CID | 67289695 |
| Molecular Formula | C9H14F3N5 |
| Molecular Weight | 249.24 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 2-[3-(2,2,2-trifluoroethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]ethanamine |
| SMILES | NCCN1CCn2c(nnc2CC(F)(F)F)C1 |
| InChI | InChI=1S/C9H14F3N5/c10-9(11,12)5-7-14-15-8-6-16(2-1-13)3-4-17(7)8/h1-6,13H2 |
| InChIKey | XUCVIULBQLFKGQ-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.24 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |