C17H17F3N2O4 — CID 67290555
N-[(1R)-1-(5-methoxy-2-pyridinyl)ethyl]-2-[2-(trifluoromethoxy)phenoxy]acetamide (PubChem CID 67290555) has the molecular formula C17H17F3N2O4 and a molecular weight of 370.33 g/mol. Its IUPAC name is N-[(1R)-1-(5-methoxy-2-pyridinyl)ethyl]-2-[2-(trifluoromethoxy)phenoxy]acetamide.
| Compound Name | N-[(1R)-1-(5-methoxy-2-pyridinyl)ethyl]-2-[2-(trifluoromethoxy)phenoxy]acetamide |
|---|---|
| PubChem CID | 67290555 |
| Molecular Formula | C17H17F3N2O4 |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | N-[(1R)-1-(5-methoxy-2-pyridinyl)ethyl]-2-[2-(trifluoromethoxy)phenoxy]acetamide |
| SMILES | COc1ccc([C@@H](C)NC(=O)COc2ccccc2OC(F)(F)F)nc1 |
| InChI | InChI=1S/C17H17F3N2O4/c1-11(13-8-7-12(24-2)9-21-13)22-16(23)10-25-14-5-3-4-6-15(14)26-17(18,19)20/h3-9,11H,10H2,1-2H3,(H,22,23)/t11-/m1/s1 |
| InChIKey | ZHMTWTVJJVCHSB-LLVKDONJSA-N |
| XLogP | 3.24 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |