C18H21NO4S — CID 67291583
(2S,3R,4S,5S)-2-[[5-(3,4-dimethylphenyl)-3-pyridinyl]oxy]thiane-3,4,5-triol (PubChem CID 67291583) has the molecular formula C18H21NO4S and a molecular weight of 347.44 g/mol. Its IUPAC name is (2S,3R,4S,5S)-2-[[5-(3,4-dimethylphenyl)-3-pyridinyl]oxy]thiane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S)-2-[[5-(3,4-dimethylphenyl)-3-pyridinyl]oxy]thiane-3,4,5-triol |
|---|---|
| PubChem CID | 67291583 |
| Molecular Formula | C18H21NO4S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | (2S,3R,4S,5S)-2-[[5-(3,4-dimethylphenyl)-3-pyridinyl]oxy]thiane-3,4,5-triol |
| SMILES | Cc1ccc(-c2cncc(O[C@H]3SC[C@@H](O)[C@H](O)[C@H]3O)c2)cc1C |
| InChI | InChI=1S/C18H21NO4S/c1-10-3-4-12(5-11(10)2)13-6-14(8-19-7-13)23-18-17(22)16(21)15(20)9-24-18/h3-8,15-18,20-22H,9H2,1-2H3/t15-,16+,17-,18+/m1/s1 |
| InChIKey | CXJNPOZXTUQBMI-XDNAFOTISA-N |
| XLogP | 1.90 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |