C33H39Cl2N5O4 — CID 67291673
benzyl N-[1-[[(3R)-6,8-dichloro-3-[[(1S)-1-cyano-3-methylbutyl]carbamoyl]-1,2,4,9-tetrahydrocarbazol-3-yl]amino]-3-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 67291673) has the molecular formula C33H39Cl2N5O4 and a molecular weight of 640.61 g/mol. Its IUPAC name is benzyl N-[1-[[(3R)-6,8-dichloro-3-[[(1S)-1-cyano-3-methylbutyl]carbamoyl]-1,2,4,9-tetrahydrocarbazol-3-yl]amino]-3-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[1-[[(3R)-6,8-dichloro-3-[[(1S)-1-cyano-3-methylbutyl]carbamoyl]-1,2,4,9-tetrahydrocarbazol-3-yl]amino]-3-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 67291673 |
| Molecular Formula | C33H39Cl2N5O4 |
| Molecular Weight | 640.61 g/mol |
| Exact Mass | 639.24 |
| IUPAC Name | benzyl N-[1-[[(3R)-6,8-dichloro-3-[[(1S)-1-cyano-3-methylbutyl]carbamoyl]-1,2,4,9-tetrahydrocarbazol-3-yl]amino]-3-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CCC(C)C(NC(=O)OCc1ccccc1)C(=O)N[C@]1(C(=O)N[C@H](C#N)CC(C)C)CCc2[nH]c3c(Cl)cc(Cl)cc3c2C1 |
| InChI | InChI=1S/C33H39Cl2N5O4/c1-5-20(4)28(39-32(43)44-18-21-9-7-6-8-10-21)30(41)40-33(31(42)37-23(17-36)13-19(2)3)12-11-27-25(16-33)24-14-22(34)15-26(35)29(24)38-27/h6-10,14-15,19-20,23,28,38H,5,11-13,16,18H2,1-4H3,(H,37,42)(H,39,43)(H,40,41)/t20?,23-,28?,33+/m0/s1 |
| InChIKey | JAVGHCJUYFCTGD-GATKISBGSA-N |
| XLogP | 6.21 |
| TPSA | 136.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.61 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|