About 5-fluoro-1,3-thiazole-2-carboxamide
5-fluoro-1,3-thiazole-2-carboxamide (PubChem CID 67291866) has the molecular formula C4H3FN2OS
and a molecular weight of 146.15 g/mol. Its IUPAC name is 5-fluoro-1,3-thiazole-2-carboxamide.
Molecular Properties
| Compound Name | 5-fluoro-1,3-thiazole-2-carboxamide |
| PubChem CID | 67291866 |
| Molecular Formula | C4H3FN2OS |
| Molecular Weight | 146.15 g/mol |
| Exact Mass | 146.00 |
| IUPAC Name | 5-fluoro-1,3-thiazole-2-carboxamide |
| SMILES | NC(=O)c1ncc(F)s1 |
| InChI | InChI=1S/C4H3FN2OS/c5-2-1-7-4(9-2)3(6)8/h1H,(H2,6,8) |
| InChIKey | XLOFFAYPGNIRER-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.15 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-fluoro-1,3-thiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-1,3-thiazole-2-carboxamide?
The IUPAC name of 5-fluoro-1,3-thiazole-2-carboxamide (CID 67291866) is 5-fluoro-1,3-thiazole-2-carboxamide.
What is the SMILES notation for 5-fluoro-1,3-thiazole-2-carboxamide?
The canonical SMILES for 5-fluoro-1,3-thiazole-2-carboxamide is NC(=O)c1ncc(F)s1.
What is the InChIKey of 5-fluoro-1,3-thiazole-2-carboxamide?
The InChIKey is XLOFFAYPGNIRER-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3FN2OS/c5-2-1-7-4(9-2)3(6)8/h1H,(H2,6,8).
What are the key properties of 5-fluoro-1,3-thiazole-2-carboxamide?
5-fluoro-1,3-thiazole-2-carboxamide has a molecular weight of 146.15 g/mol, XLogP of 0.38, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-1,3-thiazole-2-carboxamide is sourced from PubChem (CID 67291866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).