About bis[2-(dimethylamino)ethyl] bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate
bis[2-(dimethylamino)ethyl] bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (PubChem CID 67291911) has the molecular formula C17H28N2O4
and a molecular weight of 324.42 g/mol. Its IUPAC name is bis[2-(dimethylamino)ethyl] bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
Molecular Properties
| Compound Name | bis[2-(dimethylamino)ethyl] bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| PubChem CID | 67291911 |
| Molecular Formula | C17H28N2O4 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | bis[2-(dimethylamino)ethyl] bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| SMILES | CN(C)CCOC(=O)C1C2C=CC(C2)C1C(=O)OCCN(C)C |
| InChI | InChI=1S/C17H28N2O4/c1-18(2)7-9-22-16(20)14-12-5-6-13(11-12)15(14)17(21)23-10-8-19(3)4/h5-6,12-15H,7-11H2,1-4H3 |
| InChIKey | ZNNJFOPPCQMQBO-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bis[2-(dimethylamino)ethyl] bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[2-(dimethylamino)ethyl] bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate?
The IUPAC name of bis[2-(dimethylamino)ethyl] bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (CID 67291911) is bis[2-(dimethylamino)ethyl] bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
What is the SMILES notation for bis[2-(dimethylamino)ethyl] bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate?
The canonical SMILES for bis[2-(dimethylamino)ethyl] bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate is CN(C)CCOC(=O)C1C2C=CC(C2)C1C(=O)OCCN(C)C.
What is the InChIKey of bis[2-(dimethylamino)ethyl] bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate?
The InChIKey is ZNNJFOPPCQMQBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N2O4/c1-18(2)7-9-22-16(20)14-12-5-6-13(11-12)15(14)17(21)23-10-8-19(3)4/h5-6,12-15H,7-11H2,1-4H3.
What are the key properties of bis[2-(dimethylamino)ethyl] bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate?
bis[2-(dimethylamino)ethyl] bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate has a molecular weight of 324.42 g/mol, XLogP of 0.63, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis[2-(dimethylamino)ethyl] bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate is sourced from PubChem (CID 67291911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).