C16H16FNO4S — CID 67292155
(2S,3R,4S,5S)-2-[[2-(4-fluorophenyl)-3-pyridinyl]oxy]thiane-3,4,5-triol (PubChem CID 67292155) has the molecular formula C16H16FNO4S and a molecular weight of 337.37 g/mol. Its IUPAC name is (2S,3R,4S,5S)-2-[[2-(4-fluorophenyl)-3-pyridinyl]oxy]thiane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S)-2-[[2-(4-fluorophenyl)-3-pyridinyl]oxy]thiane-3,4,5-triol |
|---|---|
| PubChem CID | 67292155 |
| Molecular Formula | C16H16FNO4S |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | (2S,3R,4S,5S)-2-[[2-(4-fluorophenyl)-3-pyridinyl]oxy]thiane-3,4,5-triol |
| SMILES | O[C@@H]1[C@@H](O)[C@@H](Oc2cccnc2-c2ccc(F)cc2)SC[C@H]1O |
| InChI | InChI=1S/C16H16FNO4S/c17-10-5-3-9(4-6-10)13-12(2-1-7-18-13)22-16-15(21)14(20)11(19)8-23-16/h1-7,11,14-16,19-21H,8H2/t11-,14+,15-,16+/m1/s1 |
| InChIKey | XWULPWXPORIIFW-CAPXZKIUSA-N |
| XLogP | 1.42 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |