C17H16N2O4S — CID 67292252
4-[3-[(2S,3R,4S,5S)-3,4,5-trihydroxythian-2-yl]oxy-2-pyridinyl]benzonitrile (PubChem CID 67292252) has the molecular formula C17H16N2O4S and a molecular weight of 344.39 g/mol. Its IUPAC name is 4-[3-[(2S,3R,4S,5S)-3,4,5-trihydroxythian-2-yl]oxy-2-pyridinyl]benzonitrile.
| Compound Name | 4-[3-[(2S,3R,4S,5S)-3,4,5-trihydroxythian-2-yl]oxy-2-pyridinyl]benzonitrile |
|---|---|
| PubChem CID | 67292252 |
| Molecular Formula | C17H16N2O4S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 4-[3-[(2S,3R,4S,5S)-3,4,5-trihydroxythian-2-yl]oxy-2-pyridinyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ncccc2O[C@H]2SC[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C17H16N2O4S/c18-8-10-3-5-11(6-4-10)14-13(2-1-7-19-14)23-17-16(22)15(21)12(20)9-24-17/h1-7,12,15-17,20-22H,9H2/t12-,15+,16-,17+/m1/s1 |
| InChIKey | MUXCFQRUSUZQNW-ZFVVBOAOSA-N |
| XLogP | 1.15 |
| TPSA | 106.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |