About 2-methyl-1,3-oxazole-4-carbonitrile;1-(2-methyl-1,3-oxazol-4-yl)cyclopropan-1-amine
2-methyl-1,3-oxazole-4-carbonitrile;1-(2-methyl-1,3-oxazol-4-yl)cyclopropan-1-amine (PubChem CID 67292473) has the molecular formula C12H14N4O2
and a molecular weight of 246.27 g/mol. Its IUPAC name is 2-methyl-1,3-oxazole-4-carbonitrile;1-(2-methyl-1,3-oxazol-4-yl)cyclopropan-1-amine.
Molecular Properties
| Compound Name | 2-methyl-1,3-oxazole-4-carbonitrile;1-(2-methyl-1,3-oxazol-4-yl)cyclopropan-1-amine |
| PubChem CID | 67292473 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 2-methyl-1,3-oxazole-4-carbonitrile;1-(2-methyl-1,3-oxazol-4-yl)cyclopropan-1-amine |
| SMILES | Cc1nc(C#N)co1.Cc1nc(C2(N)CC2)co1 |
| InChI | InChI=1S/C7H10N2O.C5H4N2O/c1-5-9-6(4-10-5)7(8)2-3-7;1-4-7-5(2-6)3-8-4/h4H,2-3,8H2,1H3;3H,1H3 |
| InChIKey | CKRKGXDXBKLVBZ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 101.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-methyl-1,3-oxazole-4-carbonitrile;1-(2-methyl-1,3-oxazol-4-yl)cyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1,3-oxazole-4-carbonitrile;1-(2-methyl-1,3-oxazol-4-yl)cyclopropan-1-amine?
The IUPAC name of 2-methyl-1,3-oxazole-4-carbonitrile;1-(2-methyl-1,3-oxazol-4-yl)cyclopropan-1-amine (CID 67292473) is 2-methyl-1,3-oxazole-4-carbonitrile;1-(2-methyl-1,3-oxazol-4-yl)cyclopropan-1-amine.
What is the SMILES notation for 2-methyl-1,3-oxazole-4-carbonitrile;1-(2-methyl-1,3-oxazol-4-yl)cyclopropan-1-amine?
The canonical SMILES for 2-methyl-1,3-oxazole-4-carbonitrile;1-(2-methyl-1,3-oxazol-4-yl)cyclopropan-1-amine is Cc1nc(C#N)co1.Cc1nc(C2(N)CC2)co1.
What is the InChIKey of 2-methyl-1,3-oxazole-4-carbonitrile;1-(2-methyl-1,3-oxazol-4-yl)cyclopropan-1-amine?
The InChIKey is CKRKGXDXBKLVBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O.C5H4N2O/c1-5-9-6(4-10-5)7(8)2-3-7;1-4-7-5(2-6)3-8-4/h4H,2-3,8H2,1H3;3H,1H3.
What are the key properties of 2-methyl-1,3-oxazole-4-carbonitrile;1-(2-methyl-1,3-oxazol-4-yl)cyclopropan-1-amine?
2-methyl-1,3-oxazole-4-carbonitrile;1-(2-methyl-1,3-oxazol-4-yl)cyclopropan-1-amine has a molecular weight of 246.27 g/mol, XLogP of 1.79, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1,3-oxazole-4-carbonitrile;1-(2-methyl-1,3-oxazol-4-yl)cyclopropan-1-amine is sourced from PubChem (CID 67292473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).