About bicyclo[2.2.1]heptane;2-bromo-N-carbamoyl-2-ethylbutanamide
bicyclo[2.2.1]heptane;2-bromo-N-carbamoyl-2-ethylbutanamide (PubChem CID 67292805) has the molecular formula C14H25BrN2O2
and a molecular weight of 333.27 g/mol. Its IUPAC name is bicyclo[2.2.1]heptane;2-bromo-N-carbamoyl-2-ethylbutanamide.
Molecular Properties
| Compound Name | bicyclo[2.2.1]heptane;2-bromo-N-carbamoyl-2-ethylbutanamide |
| PubChem CID | 67292805 |
| Molecular Formula | C14H25BrN2O2 |
| Molecular Weight | 333.27 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | bicyclo[2.2.1]heptane;2-bromo-N-carbamoyl-2-ethylbutanamide |
| SMILES | C1CC2CCC1C2.CCC(Br)(CC)C(=O)NC(N)=O |
| InChI | InChI=1S/C7H13BrN2O2.C7H12/c1-3-7(8,4-2)5(11)10-6(9)12;1-2-7-4-3-6(1)5-7/h3-4H2,1-2H3,(H3,9,10,11,12);6-7H,1-5H2 |
| InChIKey | REKJEVNTIYBUIE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.27 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[2.2.1]heptane;2-bromo-N-carbamoyl-2-ethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.1]heptane;2-bromo-N-carbamoyl-2-ethylbutanamide?
The IUPAC name of bicyclo[2.2.1]heptane;2-bromo-N-carbamoyl-2-ethylbutanamide (CID 67292805) is bicyclo[2.2.1]heptane;2-bromo-N-carbamoyl-2-ethylbutanamide.
What is the SMILES notation for bicyclo[2.2.1]heptane;2-bromo-N-carbamoyl-2-ethylbutanamide?
The canonical SMILES for bicyclo[2.2.1]heptane;2-bromo-N-carbamoyl-2-ethylbutanamide is C1CC2CCC1C2.CCC(Br)(CC)C(=O)NC(N)=O.
What is the InChIKey of bicyclo[2.2.1]heptane;2-bromo-N-carbamoyl-2-ethylbutanamide?
The InChIKey is REKJEVNTIYBUIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13BrN2O2.C7H12/c1-3-7(8,4-2)5(11)10-6(9)12;1-2-7-4-3-6(1)5-7/h3-4H2,1-2H3,(H3,9,10,11,12);6-7H,1-5H2.
What are the key properties of bicyclo[2.2.1]heptane;2-bromo-N-carbamoyl-2-ethylbutanamide?
bicyclo[2.2.1]heptane;2-bromo-N-carbamoyl-2-ethylbutanamide has a molecular weight of 333.27 g/mol, XLogP of 3.33, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.1]heptane;2-bromo-N-carbamoyl-2-ethylbutanamide is sourced from PubChem (CID 67292805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).