About [(2S,4R)-4-fluoropyrrolidin-2-yl]methanol;hydrochloride
[(2S,4R)-4-fluoropyrrolidin-2-yl]methanol;hydrochloride (PubChem CID 67293842) has the molecular formula C5H11ClFNO
and a molecular weight of 155.60 g/mol. Its IUPAC name is [(2S,4R)-4-fluoropyrrolidin-2-yl]methanol;hydrochloride.
Molecular Properties
| Compound Name | [(2S,4R)-4-fluoropyrrolidin-2-yl]methanol;hydrochloride |
| PubChem CID | 67293842 |
| Molecular Formula | C5H11ClFNO |
| Molecular Weight | 155.60 g/mol |
| Exact Mass | 155.05 |
| IUPAC Name | [(2S,4R)-4-fluoropyrrolidin-2-yl]methanol;hydrochloride |
| SMILES | Cl.OC[C@@H]1C[C@@H](F)CN1 |
| InChI | InChI=1S/C5H10FNO.ClH/c6-4-1-5(3-8)7-2-4;/h4-5,7-8H,1-3H2;1H/t4-,5+;/m1./s1 |
| InChIKey | MCSMAEKVMQAPIQ-JBUOLDKXSA-N |
| XLogP | 0.10 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.60 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(2S,4R)-4-fluoropyrrolidin-2-yl]methanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,4R)-4-fluoropyrrolidin-2-yl]methanol;hydrochloride?
The IUPAC name of [(2S,4R)-4-fluoropyrrolidin-2-yl]methanol;hydrochloride (CID 67293842) is [(2S,4R)-4-fluoropyrrolidin-2-yl]methanol;hydrochloride.
What is the SMILES notation for [(2S,4R)-4-fluoropyrrolidin-2-yl]methanol;hydrochloride?
The canonical SMILES for [(2S,4R)-4-fluoropyrrolidin-2-yl]methanol;hydrochloride is Cl.OC[C@@H]1C[C@@H](F)CN1.
What is the InChIKey of [(2S,4R)-4-fluoropyrrolidin-2-yl]methanol;hydrochloride?
The InChIKey is MCSMAEKVMQAPIQ-JBUOLDKXSA-N. The full InChI is InChI=1S/C5H10FNO.ClH/c6-4-1-5(3-8)7-2-4;/h4-5,7-8H,1-3H2;1H/t4-,5+;/m1./s1.
What are the key properties of [(2S,4R)-4-fluoropyrrolidin-2-yl]methanol;hydrochloride?
[(2S,4R)-4-fluoropyrrolidin-2-yl]methanol;hydrochloride has a molecular weight of 155.60 g/mol, XLogP of 0.10, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,4R)-4-fluoropyrrolidin-2-yl]methanol;hydrochloride is sourced from PubChem (CID 67293842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).