About tert-butyl (2S,4R)-4-tert-butylsulfonyl-2-(trityloxymethyl)pyrrolidine-1-carboxylate
tert-butyl (2S,4R)-4-tert-butylsulfonyl-2-(trityloxymethyl)pyrrolidine-1-carboxylate (PubChem CID 67293902) has the molecular formula C33H41NO5S
and a molecular weight of 563.76 g/mol. Its IUPAC name is tert-butyl (2S,4R)-4-tert-butylsulfonyl-2-(trityloxymethyl)pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (2S,4R)-4-tert-butylsulfonyl-2-(trityloxymethyl)pyrrolidine-1-carboxylate |
| PubChem CID | 67293902 |
| Molecular Formula | C33H41NO5S |
| Molecular Weight | 563.76 g/mol |
| Exact Mass | 563.27 |
| IUPAC Name | tert-butyl (2S,4R)-4-tert-butylsulfonyl-2-(trityloxymethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](S(=O)(=O)C(C)(C)C)C[C@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H41NO5S/c1-31(2,3)39-30(35)34-23-29(40(36,37)32(4,5)6)22-28(34)24-38-33(25-16-10-7-11-17-25,26-18-12-8-13-19-26)27-20-14-9-15-21-27/h7-21,28-29H,22-24H2,1-6H3/t28-,29+/m0/s1 |
| InChIKey | FADBMVIIFXEETO-URLMMPGGSA-N |
| XLogP | 6.59 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 563.76 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (2S,4R)-4-tert-butylsulfonyl-2-(trityloxymethyl)pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2S,4R)-4-tert-butylsulfonyl-2-(trityloxymethyl)pyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl (2S,4R)-4-tert-butylsulfonyl-2-(trityloxymethyl)pyrrolidine-1-carboxylate (CID 67293902) is tert-butyl (2S,4R)-4-tert-butylsulfonyl-2-(trityloxymethyl)pyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl (2S,4R)-4-tert-butylsulfonyl-2-(trityloxymethyl)pyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl (2S,4R)-4-tert-butylsulfonyl-2-(trityloxymethyl)pyrrolidine-1-carboxylate is CC(C)(C)OC(=O)N1C[C@H](S(=O)(=O)C(C)(C)C)C[C@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of tert-butyl (2S,4R)-4-tert-butylsulfonyl-2-(trityloxymethyl)pyrrolidine-1-carboxylate?
The InChIKey is FADBMVIIFXEETO-URLMMPGGSA-N. The full InChI is InChI=1S/C33H41NO5S/c1-31(2,3)39-30(35)34-23-29(40(36,37)32(4,5)6)22-28(34)24-38-33(25-16-10-7-11-17-25,26-18-12-8-13-19-26)27-20-14-9-15-21-27/h7-21,28-29H,22-24H2,1-6H3/t28-,29+/m0/s1.
What are the key properties of tert-butyl (2S,4R)-4-tert-butylsulfonyl-2-(trityloxymethyl)pyrrolidine-1-carboxylate?
tert-butyl (2S,4R)-4-tert-butylsulfonyl-2-(trityloxymethyl)pyrrolidine-1-carboxylate has a molecular weight of 563.76 g/mol, XLogP of 6.59, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2S,4R)-4-tert-butylsulfonyl-2-(trityloxymethyl)pyrrolidine-1-carboxylate is sourced from PubChem (CID 67293902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).