C7H11F3N2O — CID 67293912
(3S)-N-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide (PubChem CID 67293912) has the molecular formula C7H11F3N2O and a molecular weight of 196.17 g/mol. Its IUPAC name is (3S)-N-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 67293912 |
| Molecular Formula | C7H11F3N2O |
| Molecular Weight | 196.17 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | (3S)-N-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide |
| SMILES | O=C(NCC(F)(F)F)[C@H]1CCNC1 |
| InChI | InChI=1S/C7H11F3N2O/c8-7(9,10)4-12-6(13)5-1-2-11-3-5/h5,11H,1-4H2,(H,12,13)/t5-/m0/s1 |
| InChIKey | GZUYLFMBSAAMAO-YFKPBYRVSA-N |
| XLogP | 0.27 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.17 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |