C36H24BrN7 — CID 67294194
N-(4-bromophenyl)-N-(4,6-diphenyl-1,3,5-triazin-2-yl)-4,6-diphenyl-1,3,5-triazin-2-amine (PubChem CID 67294194) has the molecular formula C36H24BrN7 and a molecular weight of 634.54 g/mol. Its IUPAC name is N-(4-bromophenyl)-N-(4,6-diphenyl-1,3,5-triazin-2-yl)-4,6-diphenyl-1,3,5-triazin-2-amine.
| Compound Name | N-(4-bromophenyl)-N-(4,6-diphenyl-1,3,5-triazin-2-yl)-4,6-diphenyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 67294194 |
| Molecular Formula | C36H24BrN7 |
| Molecular Weight | 634.54 g/mol |
| Exact Mass | 633.13 |
| IUPAC Name | N-(4-bromophenyl)-N-(4,6-diphenyl-1,3,5-triazin-2-yl)-4,6-diphenyl-1,3,5-triazin-2-amine |
| SMILES | Brc1ccc(N(c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c2nc(-c3ccccc3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C36H24BrN7/c37-29-21-23-30(24-22-29)44(35-40-31(25-13-5-1-6-14-25)38-32(41-35)26-15-7-2-8-16-26)36-42-33(27-17-9-3-10-18-27)39-34(43-36)28-19-11-4-12-20-28/h1-24H |
| InChIKey | ZRQPUVBHMPYLGQ-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 80.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.54 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |