About 2-fluoropyridine;2-[(3S)-pyrrolidin-3-yl]ethanol
2-fluoropyridine;2-[(3S)-pyrrolidin-3-yl]ethanol (PubChem CID 67294296) has the molecular formula C11H17FN2O
and a molecular weight of 212.27 g/mol. Its IUPAC name is 2-fluoropyridine;2-[(3S)-pyrrolidin-3-yl]ethanol.
Molecular Properties
| Compound Name | 2-fluoropyridine;2-[(3S)-pyrrolidin-3-yl]ethanol |
| PubChem CID | 67294296 |
| Molecular Formula | C11H17FN2O |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 2-fluoropyridine;2-[(3S)-pyrrolidin-3-yl]ethanol |
| SMILES | Fc1ccccn1.OCC[C@@H]1CCNC1 |
| InChI | InChI=1S/C6H13NO.C5H4FN/c8-4-2-6-1-3-7-5-6;6-5-3-1-2-4-7-5/h6-8H,1-5H2;1-4H/t6-;/m0./s1 |
| InChIKey | HIKDDOFSTJQNFD-RGMNGODLSA-N |
| XLogP | 1.20 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoropyridine;2-[(3S)-pyrrolidin-3-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoropyridine;2-[(3S)-pyrrolidin-3-yl]ethanol?
The IUPAC name of 2-fluoropyridine;2-[(3S)-pyrrolidin-3-yl]ethanol (CID 67294296) is 2-fluoropyridine;2-[(3S)-pyrrolidin-3-yl]ethanol.
What is the SMILES notation for 2-fluoropyridine;2-[(3S)-pyrrolidin-3-yl]ethanol?
The canonical SMILES for 2-fluoropyridine;2-[(3S)-pyrrolidin-3-yl]ethanol is Fc1ccccn1.OCC[C@@H]1CCNC1.
What is the InChIKey of 2-fluoropyridine;2-[(3S)-pyrrolidin-3-yl]ethanol?
The InChIKey is HIKDDOFSTJQNFD-RGMNGODLSA-N. The full InChI is InChI=1S/C6H13NO.C5H4FN/c8-4-2-6-1-3-7-5-6;6-5-3-1-2-4-7-5/h6-8H,1-5H2;1-4H/t6-;/m0./s1.
What are the key properties of 2-fluoropyridine;2-[(3S)-pyrrolidin-3-yl]ethanol?
2-fluoropyridine;2-[(3S)-pyrrolidin-3-yl]ethanol has a molecular weight of 212.27 g/mol, XLogP of 1.20, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoropyridine;2-[(3S)-pyrrolidin-3-yl]ethanol is sourced from PubChem (CID 67294296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).