C37H58N6O6Si2 — CID 67294452
tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-methoxycarbonyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 67294452) has the molecular formula C37H58N6O6Si2 and a molecular weight of 739.08 g/mol. Its IUPAC name is tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-methoxycarbonyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-methoxycarbonyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 67294452 |
| Molecular Formula | C37H58N6O6Si2 |
| Molecular Weight | 739.08 g/mol |
| Exact Mass | 738.40 |
| IUPAC Name | tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-methoxycarbonyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | COC(=O)c1ccc(-c2cnn3c(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)cc(C4CC5CCC(C4)N5C(=O)OC(C)(C)C)nc23)cn1 |
| InChI | InChI=1S/C37H58N6O6Si2/c1-37(2,3)49-36(45)42-28-12-13-29(42)20-27(19-28)32-21-33(41(24-47-15-17-50(5,6)7)25-48-16-18-51(8,9)10)43-34(40-32)30(23-39-43)26-11-14-31(38-22-26)35(44)46-4/h11,14,21-23,27-29H,12-13,15-20,24-25H2,1-10H3 |
| InChIKey | CGNIPYAKRAOPJT-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 120.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.08 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|