C38H61FN6O5Si2 — CID 67294491
tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-[5-fluoro-6-(2-hydroxypropan-2-yl)-3-pyridinyl]pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 67294491) has the molecular formula C38H61FN6O5Si2 and a molecular weight of 757.11 g/mol. Its IUPAC name is tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-[5-fluoro-6-(2-hydroxypropan-2-yl)-3-pyridinyl]pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-[5-fluoro-6-(2-hydroxypropan-2-yl)-3-pyridinyl]pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 67294491 |
| Molecular Formula | C38H61FN6O5Si2 |
| Molecular Weight | 757.11 g/mol |
| Exact Mass | 756.42 |
| IUPAC Name | tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-[5-fluoro-6-(2-hydroxypropan-2-yl)-3-pyridinyl]pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1CC(c1cc(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)n3ncc(-c4cnc(C(C)(C)O)c(F)c4)c3n1)C2 |
| InChI | InChI=1S/C38H61FN6O5Si2/c1-37(2,3)50-36(46)44-28-12-13-29(44)19-26(18-28)32-21-33(43(24-48-14-16-51(6,7)8)25-49-15-17-52(9,10)11)45-35(42-32)30(23-41-45)27-20-31(39)34(40-22-27)38(4,5)47/h20-23,26,28-29,47H,12-19,24-25H2,1-11H3 |
| InChIKey | BDFCIDZWCQESFC-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 114.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.11 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|