C41H59FN6O4Si2 — CID 67294669
tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-fluoro-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 67294669) has the molecular formula C41H59FN6O4Si2 and a molecular weight of 775.13 g/mol. Its IUPAC name is tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-fluoro-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-fluoro-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 67294669 |
| Molecular Formula | C41H59FN6O4Si2 |
| Molecular Weight | 775.13 g/mol |
| Exact Mass | 774.41 |
| IUPAC Name | tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-fluoro-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1CC(c1nc3c(-c4ccc(-c5ccccc5)nc4)cnn3c(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)c1F)C2 |
| InChI | InChI=1S/C41H59FN6O4Si2/c1-41(2,3)52-40(49)47-32-16-17-33(47)24-31(23-32)37-36(42)39(46(27-50-19-21-53(4,5)6)28-51-20-22-54(7,8)9)48-38(45-37)34(26-44-48)30-15-18-35(43-25-30)29-13-11-10-12-14-29/h10-15,18,25-26,31-33H,16-17,19-24,27-28H2,1-9H3 |
| InChIKey | LBBOXOYUTDHRKU-UHFFFAOYSA-N |
| XLogP | 9.67 |
| TPSA | 94.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.13 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|