C41H58F2N6O4Si2 — CID 67294707
tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-[6-(2,6-difluorophenyl)-3-pyridinyl]pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 67294707) has the molecular formula C41H58F2N6O4Si2 and a molecular weight of 793.12 g/mol. Its IUPAC name is tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-[6-(2,6-difluorophenyl)-3-pyridinyl]pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-[6-(2,6-difluorophenyl)-3-pyridinyl]pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 67294707 |
| Molecular Formula | C41H58F2N6O4Si2 |
| Molecular Weight | 793.12 g/mol |
| Exact Mass | 792.40 |
| IUPAC Name | tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-[6-(2,6-difluorophenyl)-3-pyridinyl]pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1CC(c1cc(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)n3ncc(-c4ccc(-c5c(F)cccc5F)nc4)c3n1)C2 |
| InChI | InChI=1S/C41H58F2N6O4Si2/c1-41(2,3)53-40(50)48-30-14-15-31(48)22-29(21-30)36-23-37(47(26-51-17-19-54(4,5)6)27-52-18-20-55(7,8)9)49-39(46-36)32(25-45-49)28-13-16-35(44-24-28)38-33(42)11-10-12-34(38)43/h10-13,16,23-25,29-31H,14-15,17-22,26-27H2,1-9H3 |
| InChIKey | RUVPNSLZMVFXHI-UHFFFAOYSA-N |
| XLogP | 9.81 |
| TPSA | 94.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.12 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|