C28H27F3N6O4S — CID 67294773
1-[(1R,5S)-3-[7-amino-6-methylsulfonyl-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octan-8-yl]-3,3,3-trifluoro-2-hydroxypropan-1-one (PubChem CID 67294773) has the molecular formula C28H27F3N6O4S and a molecular weight of 600.62 g/mol. Its IUPAC name is 1-[(1R,5S)-3-[7-amino-6-methylsulfonyl-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octan-8-yl]-3,3,3-trifluoro-2-hydroxypropan-1-one.
| Compound Name | 1-[(1R,5S)-3-[7-amino-6-methylsulfonyl-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octan-8-yl]-3,3,3-trifluoro-2-hydroxypropan-1-one |
|---|---|
| PubChem CID | 67294773 |
| Molecular Formula | C28H27F3N6O4S |
| Molecular Weight | 600.62 g/mol |
| Exact Mass | 600.18 |
| IUPAC Name | 1-[(1R,5S)-3-[7-amino-6-methylsulfonyl-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octan-8-yl]-3,3,3-trifluoro-2-hydroxypropan-1-one |
| SMILES | CS(=O)(=O)c1c(C2C[C@H]3CC[C@@H](C2)N3C(=O)C(O)C(F)(F)F)nc2c(-c3ccc(-c4ccccc4)nc3)cnn2c1N |
| InChI | InChI=1S/C28H27F3N6O4S/c1-42(40,41)23-22(17-11-18-8-9-19(12-17)36(18)27(39)24(38)28(29,30)31)35-26-20(14-34-37(26)25(23)32)16-7-10-21(33-13-16)15-5-3-2-4-6-15/h2-7,10,13-14,17-19,24,38H,8-9,11-12,32H2,1H3/t17?,18-,19+,24? |
| InChIKey | ZMWKPHDUMVEBRL-JHFJLTJKSA-N |
| XLogP | 3.60 |
| TPSA | 143.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.62 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |