C39H59N7O4SSi2 — CID 67295013
tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-[6-(5-methyl-1,3-thiazol-2-yl)-3-pyridinyl]pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 67295013) has the molecular formula C39H59N7O4SSi2 and a molecular weight of 778.18 g/mol. Its IUPAC name is tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-[6-(5-methyl-1,3-thiazol-2-yl)-3-pyridinyl]pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-[6-(5-methyl-1,3-thiazol-2-yl)-3-pyridinyl]pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 67295013 |
| Molecular Formula | C39H59N7O4SSi2 |
| Molecular Weight | 778.18 g/mol |
| Exact Mass | 777.39 |
| IUPAC Name | tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-[6-(5-methyl-1,3-thiazol-2-yl)-3-pyridinyl]pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | Cc1cnc(-c2ccc(-c3cnn4c(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)cc(C5CC6CCC(C5)N6C(=O)OC(C)(C)C)nc34)cn2)s1 |
| InChI | InChI=1S/C39H59N7O4SSi2/c1-27-22-41-37(51-27)33-14-11-28(23-40-33)32-24-42-46-35(44(25-48-15-17-52(5,6)7)26-49-16-18-53(8,9)10)21-34(43-36(32)46)29-19-30-12-13-31(20-29)45(30)38(47)50-39(2,3)4/h11,14,21-24,29-31H,12-13,15-20,25-26H2,1-10H3 |
| InChIKey | IBIKOHGQSCIQKA-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 107.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.18 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|